* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IWR-1 |
CAS: | 430429-02-0 |
English Synonyms: | IWR-1 ; 4-(1,3,3A,4,7,7A-HEXAHYDRO-1,3-DIOXO-4,7-METHANO-2H-ISOINDOL-2-YL)-N-8-QUINOLINYL-BENZAMIDE |
MDL Number.: | MFCD02227506 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc2cccnc2c(c1)NC(=O)c3ccc(cc3)N4C(=O)C5C6CC(C5C4=O)C=C6 |
InChi: | InChI=1S/C25H19N3O3/c29-23(27-19-5-1-3-14-4-2-12-26-22(14)19)15-8-10-18(11-9-15)28-24(30)20-16-6-7-17(13-16)21(20)25(28)31/h1-12,16-17,20-21H,13H2,(H,27,29) |
InChiKey: | InChIKey=ZGSXEXBYLJIOGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.