* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 6447396 |
| English Synonyms: | ZERENEX E/4039396 ; EMOLECULES 6447396 |
| MDL Number.: | MFCD02227641 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)NC(=O)c3ccc4c(c3)nsn4)nsn2 |
| InChi: | InChI=1S/C13H7N5OS2/c19-13(7-4-5-8-11(6-7)17-20-15-8)14-9-2-1-3-10-12(9)18-21-16-10/h1-6H,(H,14,19) |
| InChiKey: | InChIKey=WECZKGKONQQGNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.