* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH272413 |
English Synonyms: | FCHGROUP FCH272413 |
MDL Number.: | MFCD02230135 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCC(C(=O)O)NS(=O)(=O)c1ccc(cc1)Cl |
InChi: | InChI=1S/C11H14ClNO4S/c1-2-3-10(11(14)15)13-18(16,17)9-6-4-8(12)5-7-9/h4-7,10,13H,2-3H2,1H3,(H,14,15) |
InChiKey: | InChIKey=ITOUTPBZECRSID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.