Molecular Structure:
CCD No.:CCD00301840
OTAVA-BB 1050110
Formula:C15 H15 N3
MolWeight:237.305
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1050110 |
| English Synonyms： | OTAVA-BB 1050110 |
| MDL Number.： | MFCD02232027 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | Cc1cccc2c1nc(c(c2)C#N)N3CCCC3 |
| InChi： | InChI=1S/C15H15N3/c1-11-5-4-6-12-9-13(10-16)15(17-14(11)12)18-7-2-3-8-18/h4-6,9H,2-3,7-8H2,1H3 |
| InChiKey： | InChIKey=RUCICRHWSRIJNF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
