* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QF-303 |
| English Synonyms: | QF-303 |
| MDL Number.: | MFCD02242561 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cc(c(cc1F)F)n2cc(c(=O)c3c2nc(c(c3)F)N4CC5C(C4)C5N)C(=O)O |
| InChi: | InChI=1S/C20H15F3N4O3/c21-8-1-2-15(13(22)3-8)27-7-12(20(29)30)17(28)9-4-14(23)19(25-18(9)27)26-5-10-11(6-26)16(10)24/h1-4,7,10-11,16H,5-6,24H2,(H,29,30) |
| InChiKey: | InChIKey=WVPSKSLAZQPAKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.