* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB017766 |
English Synonyms: | VITAS-BB TBB017766 |
MDL Number.: | MFCD02244540 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=C(NC(=O)CSC2=CC=CC=C2)SC(C)=C1C1=CC=C(OCC)C=C1 |
InChi: | InChI=1S/C24H25NO4S2/c1-4-28-18-13-11-17(12-14-18)21-16(3)31-23(22(21)24(27)29-5-2)25-20(26)15-30-19-9-7-6-8-10-19/h6-14H,4-5,15H2,1-3H3,(H,25,26) |
InChiKey: | InChIKey=HWDHHYAOHLKTTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.