* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021476 |
English Synonyms: | VITAS-BB TBB021476 |
MDL Number.: | MFCD02244819 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC1=CC=C(S1)C(\C)=N\NC(=O)C1=C2C=CC=CC2=NC(=C1)C1=CC=C(C=C1)C(C)(C)C |
InChi: | InChI=1S/C28H29N3OS/c1-6-21-15-16-26(33-21)18(2)30-31-27(32)23-17-25(29-24-10-8-7-9-22(23)24)19-11-13-20(14-12-19)28(3,4)5/h7-17H,6H2,1-5H3,(H,31,32)/b30-18+ |
InChiKey: | InChIKey=SCXJHMLENNCBPT-UXHLAJHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.