* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024937 |
English Synonyms: | VITAS-BB TBB024937 |
MDL Number.: | MFCD02244827 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=C(NC(=O)C(C)C)SC=C1C1=CC(C)=C(C)C=C1 |
InChi: | InChI=1S/C19H23NO3S/c1-6-23-19(22)16-15(14-8-7-12(4)13(5)9-14)10-24-18(16)20-17(21)11(2)3/h7-11H,6H2,1-5H3,(H,20,21) |
InChiKey: | InChIKey=OIVWPBIOVZRXRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.