* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021500 |
English Synonyms: | VITAS-BB TBB021500 |
MDL Number.: | MFCD02244865 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCN1CCC(CC1)=NNC(=O)C1=C2C=CC=CC2=NC(=C1)C1=CC(C)=C(C)C=C1 |
InChi: | InChI=1S/C26H30N4O/c1-4-13-30-14-11-21(12-15-30)28-29-26(31)23-17-25(20-10-9-18(2)19(3)16-20)27-24-8-6-5-7-22(23)24/h5-10,16-17H,4,11-15H2,1-3H3,(H,29,31) |
InChiKey: | InChIKey=MXDSOXAUBGPQRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.