* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020861 |
English Synonyms: | VITAS-BB TBB020861 |
MDL Number.: | MFCD02244872 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | O=C(NC1=NN=C(S1)C1CC1)C1=CSC2=C1C=CC=C2 |
InChi: | InChI=1S/C14H11N3OS2/c18-12(10-7-19-11-4-2-1-3-9(10)11)15-14-17-16-13(20-14)8-5-6-8/h1-4,7-8H,5-6H2,(H,15,17,18) |
InChiKey: | InChIKey=XTNMKBAOIKEZQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.