* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021502 |
English Synonyms: | VITAS-BB TBB021502 |
MDL Number.: | MFCD02244891 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1CCC(CC1)=NNC(=O)C1=C2C=CC=CC2=NC(=C1)C1=CC(C)=C(C)C=C1 |
InChi: | InChI=1S/C25H27N3O/c1-16-8-12-20(13-9-16)27-28-25(29)22-15-24(19-11-10-17(2)18(3)14-19)26-23-7-5-4-6-21(22)23/h4-7,10-11,14-16H,8-9,12-13H2,1-3H3,(H,28,29) |
InChiKey: | InChIKey=JMBXTJPYUUEIHR-OOAXWGSJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.