* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020859 |
English Synonyms: | VITAS-BB TBB020859 |
MDL Number.: | MFCD02244902 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | O=C(NC1=NN=C(S1)C1CCCCC1)C1=CSC2=C1C=CC=C2 |
InChi: | InChI=1S/C17H17N3OS2/c21-15(13-10-22-14-9-5-4-8-12(13)14)18-17-20-19-16(23-17)11-6-2-1-3-7-11/h4-5,8-11H,1-3,6-7H2,(H,18,20,21) |
InChiKey: | InChIKey=HNVZSDFCQJRORY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.