* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021653 |
| English Synonyms: | VITAS-BB TBB021653 |
| MDL Number.: | MFCD02244929 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCCCOC1=C(OCC)C=C(\C=N\NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC=CC=C2OC)C=C1 |
| InChi: | InChI=1S/C30H31N3O4/c1-4-6-17-37-28-16-15-21(18-29(28)36-5-2)20-31-33-30(34)24-19-26(23-12-8-10-14-27(23)35-3)32-25-13-9-7-11-22(24)25/h7-16,18-20H,4-6,17H2,1-3H3,(H,33,34)/b31-20+ |
| InChiKey: | InChIKey=ZGHCLNHEKYKCIF-AJBULDERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.