* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021625 |
English Synonyms: | VITAS-BB TBB021625 |
MDL Number.: | MFCD02244973 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCCOC1=C(OC)C=C(\C=N\NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC=CC=C2OC)C=C1 |
InChi: | InChI=1S/C28H27N3O4/c1-4-15-35-26-14-13-19(16-27(26)34-3)18-29-31-28(32)22-17-24(21-10-6-8-12-25(21)33-2)30-23-11-7-5-9-20(22)23/h5-14,16-18H,4,15H2,1-3H3,(H,31,32)/b29-18+ |
InChiKey: | InChIKey=KJVRVVFTGGGIRM-RDRPBHBLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.