* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB020860 |
English Synonyms: | VITAS-BB TBB020860 |
MDL Number.: | MFCD02245030 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)C2=CSC3=C2C=CC=C3)SC2=C1C1=CC=CC=C1CC2 |
InChi: | InChI=1S/C23H17NO3S2/c1-27-23(26)20-19-14-7-3-2-6-13(14)10-11-18(19)29-22(20)24-21(25)16-12-28-17-9-5-4-8-15(16)17/h2-9,12H,10-11H2,1H3,(H,24,25) |
InChiKey: | InChIKey=LOPABWSRAPVMEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.