* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023943 |
English Synonyms: | VITAS-BB TBB023943 |
MDL Number.: | MFCD02245073 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | O=C1C2C3CCC(C3)C2C(=O)N1C1=CC2=C(OCCO2)C=C1 |
InChi: | InChI=1S/C17H17NO4/c19-16-14-9-1-2-10(7-9)15(14)17(20)18(16)11-3-4-12-13(8-11)22-6-5-21-12/h3-4,8-10,14-15H,1-2,5-7H2 |
InChiKey: | InChIKey=DJHCEILBTIOMCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.