* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021585 |
English Synonyms: | VITAS-BB TBB021585 |
MDL Number.: | MFCD02245089 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCC(C)C1=CC=C(C=C1)C1=CC(C(=O)N\N=C\C2=CC3=C(OCO3)C=C2)=C2C=CC=CC2=N1 |
InChi: | InChI=1S/C28H25N3O3/c1-3-18(2)20-9-11-21(12-10-20)25-15-23(22-6-4-5-7-24(22)30-25)28(32)31-29-16-19-8-13-26-27(14-19)34-17-33-26/h4-16,18H,3,17H2,1-2H3,(H,31,32)/b29-16+ |
InChiKey: | InChIKey=ZTBHSOMNUZXTNB-MUFRIFMGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.