* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021343 |
English Synonyms: | VITAS-BB TBB021343 |
MDL Number.: | MFCD02245118 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(C)C1=CC=C(C=C1)C1=CSC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C1C(=O)OC(C)C |
InChi: | InChI=1S/C23H22F9NO3S/c1-5-12(4)13-6-8-14(9-7-13)15-10-37-17(16(15)18(34)36-11(2)3)33-19(35)20(24,25)21(26,27)22(28,29)23(30,31)32/h6-12H,5H2,1-4H3,(H,33,35) |
InChiKey: | InChIKey=BRJQWWTWIIHNIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.