* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 4-(2-CHLORO-3-PYRIDYL)-4-OXOBUTYRATE |
| CAS: | 852063-32-2 |
| English Synonyms: | ETHYL 4-(2-CHLORO-3-PYRIDYL)-4-OXOBUTYRATE |
| MDL Number.: | MFCD02260480 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCC(=O)c1cccnc1Cl |
| InChi: | InChI=1S/C11H12ClNO3/c1-2-16-10(15)6-5-9(14)8-4-3-7-13-11(8)12/h3-4,7H,2,5-6H2,1H3 |
| InChiKey: | InChIKey=HYJCUSFTYDWKMU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.