* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | EMOLECULES 43677205 |
English Synonyms: | EMOLECULES 43677205 |
MDL Number.: | MFCD02261924 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1ccc(cc1OC)C(C=O)C=O |
InChi: | InChI=1S/C11H12O4/c1-14-10-4-3-8(5-11(10)15-2)9(6-12)7-13/h3-7,9H,1-2H3 |
InChiKey: | InChIKey=YOASSMXDNWKFTJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.