* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 2,3'-DIENEVALPROIC ACID |
| English Synonyms: | ETHYL 2,3'-DIENEVALPROIC ACID |
| MDL Number.: | MFCD02262174 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC/C=C(\C=C\C)/C(=O)OCC |
| InChi: | InChI=1S/C10H16O2/c1-4-7-9(8-5-2)10(11)12-6-3/h4,7-8H,5-6H2,1-3H3/b7-4+,9-8+ |
| InChiKey: | InChIKey=FKTAYPPPTCPRQL-NUXDXBQRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.