* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-FLUOROFLUORENE |
CAS: | 20825-90-5 |
English Synonyms: | 9-FLUOROFLUORENE |
MDL Number.: | MFCD02262185 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)-c3ccccc3C2F |
InChi: | InChI=1S/C13H9F/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H |
InChiKey: | InChIKey=GWUJNUYVLNPPHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.