* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 13728649 |
| English Synonyms: | EMOLECULES 13728649 ; SPECS 907/15498073 |
| MDL Number.: | MFCD02323541 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC1(CCC[C@]2([C@H]1CCC(=C2CS(=O)c3ccccc3)C=O)C)C |
| InChi: | InChI=1S/C21H28O2S/c1-20(2)12-7-13-21(3)18(16(14-22)10-11-19(20)21)15-24(23)17-8-5-4-6-9-17/h4-6,8-9,14,19H,7,10-13,15H2,1-3H3/t19-,21+,24?/m0/s1 |
| InChiKey: | InChIKey=BRLBABVJUBZFID-WXFOFVMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.