* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 5478012 |
| English Synonyms: | EMOLECULES 5478012 |
| MDL Number.: | MFCD02323753 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1Br)c(ncn2)NCC(=O)O |
| InChi: | InChI=1S/C10H8BrN3O2/c11-6-1-2-8-7(3-6)10(14-5-13-8)12-4-9(15)16/h1-3,5H,4H2,(H,15,16)(H,12,13,14) |
| InChiKey: | InChIKey=HLEPTPCIBCYAQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.