* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 26758916 |
English Synonyms: | EMOLECULES 26758916 |
MDL Number.: | MFCD02326164 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(=O)N/C(=C\c1cc2ccccc2nc1)/C(=O)O |
InChi: | InChI=1S/C14H12N2O3/c1-9(17)16-13(14(18)19)7-10-6-11-4-2-3-5-12(11)15-8-10/h2-8H,1H3,(H,16,17)(H,18,19)/b13-7- |
InChiKey: | InChIKey=RECGREYHHTZMEN-QPEQYQDCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.