* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 13730115 |
English Synonyms: | EMOLECULES 13730115 ; SPECS 056/25013036 |
MDL Number.: | MFCD02326274 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CC2[C@@H](O2)CC[C@H]3C(C1)O3 |
InChi: | InChI=1S/C9H14O2/c1-2-6-8(10-6)4-5-9-7(3-1)11-9/h6-9H,1-5H2/t6?,7?,8-,9-/m0/s1 |
InChiKey: | InChIKey=HLGDWSHQZUFCJF-PEBLOWIWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.