* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 1865500 |
| English Synonyms: | EMOLECULES 1865500 |
| MDL Number.: | MFCD02363766 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c2cc(ccc2n1)Cl)Nc3ccc(cc3)C(=O)O.Cl |
| InChi: | InChI=1S/C17H13ClN2O2.ClH/c1-10-8-16(14-9-12(18)4-7-15(14)19-10)20-13-5-2-11(3-6-13)17(21)22;/h2-9H,1H3,(H,19,20)(H,21,22);1H |
| InChiKey: | InChIKey=BEZPPRDSBVTDPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.