* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL 2-[4-OXO-2-(4H-1,2,4-TRIAZOL-4-YLIMINO)-1,3-THIAZOLAN-3-YL]ACETATE |
CAS: | 478077-82-6 |
English Synonyms: | ETHYL 2-[4-OXO-2-(4H-1,2,4-TRIAZOL-4-YLIMINO)-1,3-THIAZOLAN-3-YL]ACETATE |
MDL Number.: | MFCD02570899 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CCOC(=O)CN\1C(=O)CS/C1=N\n2cnnc2 |
InChi: | InChI=1S/C9H11N5O3S/c1-2-17-8(16)3-14-7(15)4-18-9(14)12-13-5-10-11-6-13/h5-6H,2-4H2,1H3/b12-9- |
InChiKey: | InChIKey=WQIVYPUAAHMEBH-XFXZXTDPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.