* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL 2-[2-(1H-1,2,4-TRIAZOL-1-YLMETHYL)-1,3-THIAZOL-4-YL]ACETATE |
English Synonyms: | ETHYL 2-[2-(1H-1,2,4-TRIAZOL-1-YLMETHYL)-1,3-THIAZOL-4-YL]ACETATE |
MDL Number.: | MFCD02571837 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)Cc1csc(n1)Cn2cncn2 |
InChi: | InChI=1S/C10H12N4O2S/c1-2-16-10(15)3-8-5-17-9(13-8)4-14-7-11-6-12-14/h5-7H,2-4H2,1H3 |
InChiKey: | InChIKey=DUMDELBNHJQADJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.