* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH185178 |
English Synonyms: | FCHGROUP FCH185178 |
MDL Number.: | MFCD02600588 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)C(=O)O)NC(=O)c2ccccc2O |
InChi: | InChI=1S/C14H11NO4/c16-12-8-4-2-6-10(12)13(17)15-11-7-3-1-5-9(11)14(18)19/h1-8,16H,(H,15,17)(H,18,19) |
InChiKey: | InChIKey=CDKACLITEIDAIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.