* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 2-OXO-2-(1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ACETATE |
| English Synonyms: | ETHYL 2-OXO-2-(1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ACETATE |
| MDL Number.: | MFCD02620017 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C(=O)N1CCCc2c1cccc2 |
| InChi: | InChI=1S/C13H15NO3/c1-2-17-13(16)12(15)14-9-5-7-10-6-3-4-8-11(10)14/h3-4,6,8H,2,5,7,9H2,1H3 |
| InChiKey: | InChIKey=VKNITXPXVPYYKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.