* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH104963 |
| English Synonyms: | FCHGROUP FCH104963 |
| MDL Number.: | MFCD02641001 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | Cc1ccc(o1)C(=O)NCC(=O)NCC(=O)O |
| InChi: | InChI=1S/C10H12N2O5/c1-6-2-3-7(17-6)10(16)12-4-8(13)11-5-9(14)15/h2-3H,4-5H2,1H3,(H,11,13)(H,12,16)(H,14,15) |
| InChiKey: | InChIKey=DUEOMUUMTMEEPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.