* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(2-(4-BROMOPHENYL)-1-ME-2-OXOETHYL)-3-METHYL-3,9-DIHYDRO-1H-PURINE-2,6-DIONE |
English Synonyms: | 9-(2-(4-BROMOPHENYL)-1-ME-2-OXOETHYL)-3-METHYL-3,9-DIHYDRO-1H-PURINE-2,6-DIONE |
MDL Number.: | MFCD02660272 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C(=O)c1ccc(cc1)Br)n2cnc3c2n(c(=O)[nH]c3=O)C |
InChi: | InChI=1S/C15H13BrN4O3/c1-8(12(21)9-3-5-10(16)6-4-9)20-7-17-11-13(22)18-15(23)19(2)14(11)20/h3-8H,1-2H3,(H,18,22,23) |
InChiKey: | InChIKey=BUEAMIWWFIXVEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.