* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EICOSATRIENOIC ACID 5,11,14-[1-14C] |
| English Synonyms: | EICOSATRIENOIC ACID 5,11,14-[1-14C] |
| MDL Number.: | MFCD02682709 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCC/C=C/C/C=C/CCCC/C=C/CCC[14C](=O)O |
| InChi: | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,15-16H,2-5,8,11-14,17-19H2,1H3,(H,21,22)/b7-6+,10-9+,16-15+/i20+2 |
| InChiKey: | InChIKey=PRHHYVQTPBEDFE-AQRIMWBOSA-N |
|
|
| Information: | EICOSATRIENOIC ACID 5,11,14- [1-14C] (20:3) |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.