* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EPI-TRIPTOLIDE |
| CAS: | 73543-06-3 ;147852-78-6 |
| English Synonyms: | TRIPTOLIDE, EPI- ; EPI-TRIPTOLIDE |
| MDL Number.: | MFCD02682945 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)[C@@]1([C@H]([C@H]2[C@@]3(O2)[C@]4(CCC5=C([C@@H]4C[C@H]6[C@]3([C@@H]1O)O6)COC5=O)C)O)O |
| InChi: | InChI=1S/C20H26O7/c1-8(2)18(24)13(21)14-20(27-14)17(3)5-4-9-10(7-25-15(9)22)11(17)6-12-19(20,26-12)16(18)23/h8,11-14,16,21,23-24H,4-7H2,1-3H3/t11-,12-,13-,14-,16+,17-,18-,19+,20+/m0/s1 |
| InChiKey: | InChIKey=DYVDZVMUDBCZSA-CIVMWXNOSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.