* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GGTI-297 |
English Synonyms: | GGTI-297 |
MDL Number.: | MFCD02683590 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)c1ccc(cc1c2cccc3c2cccc3)NC[C@H](CS)N |
InChi: | InChI=1S/C26H31N3O3S/c1-16(2)12-24(26(31)32)29-25(30)22-11-10-19(28-14-18(27)15-33)13-23(22)21-9-5-7-17-6-3-4-8-20(17)21/h3-11,13,16,18,24,28,33H,12,14-15,27H2,1-2H3,(H,29,30)(H,31,32)/t18-,24+/m1/s1 |
InChiKey: | InChIKey=PKMVDYSKPDHRLR-KOSHJBKYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.