* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GANCICLOVIR, [8-14C] |
| English Synonyms: | GANCICLOVIR, [8-14C] |
| MDL Number.: | MFCD02683614 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | [14cH]1nc2c(=O)[nH]c(nc2n1COC(CO)CO)N |
| InChi: | InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17)/i3+2 |
| InChiKey: | InChIKey=IRSCQMHQWWYFCW-YZRHJBSPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.