* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCERALDEHYDE, [1-14C] |
English Synonyms: | GLYCERALDEHYDE, [1-14C] |
MDL Number.: | MFCD02683635 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C(C([14CH]=O)O)O |
InChi: | InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/i1+2 |
InChiKey: | InChIKey=MNQZXJOMYWMBOU-NJFSPNSNSA-N |
Property |
|
Comments: | 40-60 MCI(1.48-2.22 GBQ)/MMOL |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.