Molecular Structure:
CCD No.:CCD00331622
ERUCIC ACID, [3H]-
Formula:C22 O2 T42
MolWeight:422.912
![ERUCIC ACID, [3H]- Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | ERUCIC ACID, [3H]- |
| English Synonyms： | ERUCIC ACID, [3H]- |
| MDL Number.： | MFCD02683685 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | [3H]/C(=C(\[3H])/C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C(=O)O[3H])/C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])C([3H])([3H])[3H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
