* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BASIC YELLOW 57 |
| CAS: | 68391-31-1 |
| English Synonyms: | JAROCOL STRAW YELLOW ; BASIC YELLOW 57 |
| MDL Number.: | MFCD02684023 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1=NN(C(=O)C1/N=N/c2cccc(c2)[N+](C)(C)C)C3CCCCC3.[Cl-] |
| InChi: | InChI=1S/C19H28N5O.ClH/c1-14-18(19(25)23(22-14)16-10-6-5-7-11-16)21-20-15-9-8-12-17(13-15)24(2,3)4;/h8-9,12-13,16,18H,5-7,10-11H2,1-4H3;1H/q+1;/p-1/b21-20+; |
| InChiKey: | InChIKey=JPYXIJDCIUZVOP-ANVLNOONSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.