* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-BROMO-7-NITROINDOLE |
CAS: | 397864-11-8 |
English Synonyms: | 3-BROMO-7-NITROINDOLE ; 3-BROMO-7-NITRO-1H-INDOLE |
MDL Number.: | MFCD02684155 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(c[nH]c2c(c1)[N+](=O)[O-])Br |
InChi: | InChI=1S/C8H5BrN2O2/c9-6-4-10-8-5(6)2-1-3-7(8)11(12)13/h1-4,10H |
InChiKey: | InChIKey=ZJCDMQUXOJHHBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.