* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOMERULIDIAL |
| CAS: | 121843-89-8 |
| English Synonyms: | ISOMERULIDIAL |
| MDL Number.: | MFCD02751800 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1(CC2C(C3(CC3(C(=C2C1)C=O)C=O)C)O)C |
| InChi: | InChI=1S/C15H20O3/c1-13(2)4-9-10(5-13)12(18)14(3)7-15(14,8-17)11(9)6-16/h6,8,10,12,18H,4-5,7H2,1-3H3 |
| InChiKey: | InChIKey=NFLNZGQBGCPDMT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.