* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(P-NITROBENZYL)ADENINE |
CAS: | 73215-03-9 |
English Synonyms: | 9-(P-NITROBENZYL)ADENINE |
MDL Number.: | MFCD02752226 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | c1cc(ccc1Cn2cnc3c2ncnc3N)[N+](=O)[O-] |
InChi: | InChI=1S/C12H10N6O2/c13-11-10-12(15-6-14-11)17(7-16-10)5-8-1-3-9(4-2-8)18(19)20/h1-4,6-7H,5H2,(H2,13,14,15) |
InChiKey: | InChIKey=RPALJMDJHWZXMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.