* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (E)-ALPHA,BETA,2,3,4,5,6-HEPTACHLORO STYRENE |
CAS: | 29086-38-2 |
English Synonyms: | (E)-ALPHA,BETA,2,3,4,5,6-HEPTACHLORO STYRENE |
MDL Number.: | MFCD02752267 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=C(\c1c(c(c(c(c1Cl)Cl)Cl)Cl)Cl)/Cl)\Cl |
InChi: | InChI=1S/C8HCl7/c9-1-2(10)3-4(11)6(13)8(15)7(14)5(3)12/h1H/b2-1+ |
InChiKey: | InChIKey=WOYBAAGBIXHIGK-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.