* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FLAVOGLAUCIN |
| CAS: | 523-73-9 |
| English Synonyms: | FLAVOGLAUCIN |
| MDL Number.: | MFCD02752342 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCCCCc1c(cc(c(c1C=O)O)CC=C(C)C)O |
| InChi: | InChI=1S/C19H28O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h10,12-13,21-22H,4-9,11H2,1-3H3 |
| InChiKey: | InChIKey=RGRXZGKXEJHPQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.