* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDANESTROL |
| CAS: | 71855-45-3 |
| English Synonyms: | INDANESTROL |
| MDL Number.: | MFCD02752481 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCC1c2ccc(cc2C(C1c3ccc(cc3)O)C)O |
| InChi: | InChI=1S/C18H20O2/c1-3-15-16-9-8-14(20)10-17(16)11(2)18(15)12-4-6-13(19)7-5-12/h4-11,15,18-20H,3H2,1-2H3 |
| InChiKey: | InChIKey=UVOBXMBJOYYZST-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.