* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOXYLOL |
| CAS: | 111407-29-5 |
| English Synonyms: | XANTHOXYLOL |
| MDL Number.: | MFCD02752796 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COc1cc(ccc1O)[C@H]2[C@@H]3CO[C@@H]([C@@H]3CO2)c4ccc5c(c4)COC5 |
| InChi: | InChI=1S/C21H22O5/c1-23-19-7-13(4-5-18(19)22)21-17-11-25-20(16(17)10-26-21)12-2-3-14-8-24-9-15(14)6-12/h2-7,16-17,20-22H,8-11H2,1H3/t16-,17-,20-,21+/m1/s1 |
| InChiKey: | InChIKey=CORUSJDEBICCDD-DGQTTZFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.