* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 2305541 |
| English Synonyms: | EMOLECULES 2305541 |
| MDL Number.: | MFCD02946815 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1)OCCCCN2CCNCC2 |
| InChi: | InChI=1S/C15H24N2O/c1-14-5-4-6-15(13-14)18-12-3-2-9-17-10-7-16-8-11-17/h4-6,13,16H,2-3,7-12H2,1H3 |
| InChiKey: | InChIKey=NNMCIZHEUOAJCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.