* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 4-(5-[DI(1H-INDOL-3-YL)METHYL]-2-FURYL)BENZOATE |
| English Synonyms: | ETHYL 4-(5-[DI(1H-INDOL-3-YL)METHYL]-2-FURYL)BENZOATE |
| MDL Number.: | MFCD02951932 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)c1ccc(cc1)c2ccc(o2)C(c3c[nH]c4c3cccc4)c5c[nH]c6c5cccc6 |
| InChi: | InChI=1S/C30H24N2O3/c1-2-34-30(33)20-13-11-19(12-14-20)27-15-16-28(35-27)29(23-17-31-25-9-5-3-7-21(23)25)24-18-32-26-10-6-4-8-22(24)26/h3-18,29,31-32H,2H2,1H3 |
| InChiKey: | InChIKey=UMQQFNBVGFTNKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.