* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH455725 |
English Synonyms: | FCHGROUP FCH455725 |
MDL Number.: | MFCD02956608 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC(C)OC(=O)CN1C(=O)c2ccccc2S1(=O)=O |
InChi: | InChI=1S/C12H13NO5S/c1-8(2)18-11(14)7-13-12(15)9-5-3-4-6-10(9)19(13,16)17/h3-6,8H,7H2,1-2H3 |
InChiKey: | InChIKey=FULJHFVTOIYTGS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.